C31H21ClN2O2 — CID 124908552
(1R,8S,9S,13R)-11-(2-chlorophenyl)-1-(phenyliminomethyl)-11-azapentacyclo[6.5.4.214,17.02,7.09,13]nonadeca-2,4,6,14(19),15,17-hexaene-10,12-dione (PubChem CID 124908552) has the molecular formula C31H21ClN2O2 and a molecular weight of 488.97 g/mol. Its IUPAC name is (1R,8S,9S,13R)-11-(2-chlorophenyl)-1-(phenyliminomethyl)-11-azapentacyclo[6.5.4.214,17.02,7.09,13]nonadeca-2,4,6,14(19),15,17-hexaene-10,12-dione.
| Compound Name | (1R,8S,9S,13R)-11-(2-chlorophenyl)-1-(phenyliminomethyl)-11-azapentacyclo[6.5.4.214,17.02,7.09,13]nonadeca-2,4,6,14(19),15,17-hexaene-10,12-dione |
|---|---|
| PubChem CID | 124908552 |
| Molecular Formula | C31H21ClN2O2 |
| Molecular Weight | 488.97 g/mol |
| Exact Mass | 488.13 |
| IUPAC Name | (1R,8S,9S,13R)-11-(2-chlorophenyl)-1-(phenyliminomethyl)-11-azapentacyclo[6.5.4.214,17.02,7.09,13]nonadeca-2,4,6,14(19),15,17-hexaene-10,12-dione |
| SMILES | O=C1[C@H]2[C@H]3c4ccc(cc4)[C@@](/C=N/c4ccccc4)(c4ccccc43)[C@@H]2C(=O)N1c1ccccc1Cl |
| InChI | InChI=1S/C31H21ClN2O2/c32-24-12-6-7-13-25(24)34-29(35)27-26-19-14-16-20(17-15-19)31(28(27)30(34)36,23-11-5-4-10-22(23)26)18-33-21-8-2-1-3-9-21/h1-18,26-28H/b33-18+/t26-,27-,28-,31-/m0/s1 |
| InChIKey | QJTDUTCMNPKQDB-BFAWTALCSA-N |
| XLogP | 6.29 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.97 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|