C32H23ClN2O2 — CID 124907625
(1S,8S,9S,13R)-11-(2-chlorophenyl)-1-[(2-methylphenyl)iminomethyl]-11-azapentacyclo[6.5.4.214,17.02,7.09,13]nonadeca-2,4,6,14(19),15,17-hexaene-10,12-dione (PubChem CID 124907625) has the molecular formula C32H23ClN2O2 and a molecular weight of 503.00 g/mol. Its IUPAC name is (1S,8S,9S,13R)-11-(2-chlorophenyl)-1-[(2-methylphenyl)iminomethyl]-11-azapentacyclo[6.5.4.214,17.02,7.09,13]nonadeca-2,4,6,14(19),15,17-hexaene-10,12-dione.
| Compound Name | (1S,8S,9S,13R)-11-(2-chlorophenyl)-1-[(2-methylphenyl)iminomethyl]-11-azapentacyclo[6.5.4.214,17.02,7.09,13]nonadeca-2,4,6,14(19),15,17-hexaene-10,12-dione |
|---|---|
| PubChem CID | 124907625 |
| Molecular Formula | C32H23ClN2O2 |
| Molecular Weight | 503.00 g/mol |
| Exact Mass | 502.14 |
| IUPAC Name | (1S,8S,9S,13R)-11-(2-chlorophenyl)-1-[(2-methylphenyl)iminomethyl]-11-azapentacyclo[6.5.4.214,17.02,7.09,13]nonadeca-2,4,6,14(19),15,17-hexaene-10,12-dione |
| SMILES | Cc1ccccc1/N=C/[C@@]12c3ccc(cc3)[C@@H](c3ccccc31)[C@@H]1C(=O)N(c3ccccc3Cl)C(=O)[C@H]12 |
| InChI | InChI=1S/C32H23ClN2O2/c1-19-8-2-6-12-25(19)34-18-32-21-16-14-20(15-17-21)27(22-9-3-4-10-23(22)32)28-29(32)31(37)35(30(28)36)26-13-7-5-11-24(26)33/h2-18,27-29H,1H3/b34-18+/t27-,28-,29-,32+/m0/s1 |
| InChIKey | CXDPJYYYPHXEDA-VXSBXDPKSA-N |
| XLogP | 6.60 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.00 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|