C31H21N3O4 — CID 124907471
(1R,8S,9R,13R)-11-(2-nitrophenyl)-1-(phenyliminomethyl)-11-azapentacyclo[6.5.4.214,17.02,7.09,13]nonadeca-2,4,6,14(19),15,17-hexaene-10,12-dione (PubChem CID 124907471) has the molecular formula C31H21N3O4 and a molecular weight of 499.53 g/mol. Its IUPAC name is (1R,8S,9R,13R)-11-(2-nitrophenyl)-1-(phenyliminomethyl)-11-azapentacyclo[6.5.4.214,17.02,7.09,13]nonadeca-2,4,6,14(19),15,17-hexaene-10,12-dione.
| Compound Name | (1R,8S,9R,13R)-11-(2-nitrophenyl)-1-(phenyliminomethyl)-11-azapentacyclo[6.5.4.214,17.02,7.09,13]nonadeca-2,4,6,14(19),15,17-hexaene-10,12-dione |
|---|---|
| PubChem CID | 124907471 |
| Molecular Formula | C31H21N3O4 |
| Molecular Weight | 499.53 g/mol |
| Exact Mass | 499.15 |
| IUPAC Name | (1R,8S,9R,13R)-11-(2-nitrophenyl)-1-(phenyliminomethyl)-11-azapentacyclo[6.5.4.214,17.02,7.09,13]nonadeca-2,4,6,14(19),15,17-hexaene-10,12-dione |
| SMILES | O=C1[C@@H]2[C@H]3c4ccc(cc4)[C@@](/C=N/c4ccccc4)(c4ccccc43)[C@@H]2C(=O)N1c1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C31H21N3O4/c35-29-27-26-19-14-16-20(17-15-19)31(23-11-5-4-10-22(23)26,18-32-21-8-2-1-3-9-21)28(27)30(36)33(29)24-12-6-7-13-25(24)34(37)38/h1-18,26-28H/b32-18+/t26-,27+,28-,31-/m0/s1 |
| InChIKey | ARGBQGWTCNVBIQ-PUMAVZQZSA-N |
| XLogP | 5.55 |
| TPSA | 92.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.53 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|