C33H26N2O2 — CID 27042957
(15R,19S)-17-(2,4-dimethylphenyl)-1-(phenyliminomethyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 27042957) has the molecular formula C33H26N2O2 and a molecular weight of 482.58 g/mol. Its IUPAC name is (15R,19S)-17-(2,4-dimethylphenyl)-1-(phenyliminomethyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | (15R,19S)-17-(2,4-dimethylphenyl)-1-(phenyliminomethyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 27042957 |
| Molecular Formula | C33H26N2O2 |
| Molecular Weight | 482.58 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | (15R,19S)-17-(2,4-dimethylphenyl)-1-(phenyliminomethyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | Cc1ccc(N2C(=O)[C@@H]3[C@@H](C2=O)C2c4ccccc4C3(/C=N/c3ccccc3)c3ccccc32)c(C)c1 |
| InChI | InChI=1S/C33H26N2O2/c1-20-16-17-27(21(2)18-20)35-31(36)29-28-23-12-6-8-14-25(23)33(30(29)32(35)37,26-15-9-7-13-24(26)28)19-34-22-10-4-3-5-11-22/h3-19,28-30H,1-2H3/b34-19+/t28?,29-,30-,33?/m0/s1 |
| InChIKey | PBJSKFHQRQXFRA-OTDFFUQNSA-N |
| XLogP | 6.26 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.58 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|