C32H22Cl2N2O2 — CID 132956250
1-[(2,3-dichlorophenyl)iminomethyl]-17-(4-methylphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione (PubChem CID 132956250) has the molecular formula C32H22Cl2N2O2 and a molecular weight of 537.45 g/mol. Its IUPAC name is 1-[(2,3-dichlorophenyl)iminomethyl]-17-(4-methylphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione.
| Compound Name | 1-[(2,3-dichlorophenyl)iminomethyl]-17-(4-methylphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
|---|---|
| PubChem CID | 132956250 |
| Molecular Formula | C32H22Cl2N2O2 |
| Molecular Weight | 537.45 g/mol |
| Exact Mass | 536.11 |
| IUPAC Name | 1-[(2,3-dichlorophenyl)iminomethyl]-17-(4-methylphenyl)-17-azapentacyclo[6.6.5.02,7.09,14.015,19]nonadeca-2,4,6,9,11,13-hexaene-16,18-dione |
| SMILES | Cc1ccc(N2C(=O)C3C4c5ccccc5C(/C=N/c5cccc(Cl)c5Cl)(c5ccccc54)C3C2=O)cc1 |
| InChI | InChI=1S/C32H22Cl2N2O2/c1-18-13-15-19(16-14-18)36-30(37)27-26-20-7-2-4-9-22(20)32(28(27)31(36)38,23-10-5-3-8-21(23)26)17-35-25-12-6-11-24(33)29(25)34/h2-17,26-28H,1H3/b35-17+ |
| InChIKey | MORPOSCBMMYHNT-XJECJHNESA-N |
| XLogP | 7.26 |
| TPSA | 49.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.45 |
| LogP ≤ 5 | 7.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|