C16H16ClN3 — CID 135052369
1-methyl-2,3-diphenylimidazol-1-ium-4-amine chloride (PubChem CID 135052369) has the molecular formula C16H16ClN3 and a molecular weight of 285.78 g/mol. Its IUPAC name is 1-methyl-2,3-diphenylimidazol-1-ium-4-amine chloride.
| Compound Name | 1-methyl-2,3-diphenylimidazol-1-ium-4-amine chloride |
|---|---|
| PubChem CID | 135052369 |
| Molecular Formula | C16H16ClN3 |
| Molecular Weight | 285.78 g/mol |
| Exact Mass | 285.10 |
| IUPAC Name | 1-methyl-2,3-diphenylimidazol-1-ium-4-amine chloride |
| SMILES | C[n+]1cc(N)n(-c2ccccc2)c1-c1ccccc1.[Cl-] |
| InChI | InChI=1S/C16H16N3.ClH/c1-18-12-15(17)19(14-10-6-3-7-11-14)16(18)13-8-4-2-5-9-13;/h2-12H,17H2,1H3;1H/q+1;/p-1 |
| InChIKey | HGENWMJDMQIFKU-UHFFFAOYSA-M |
| XLogP | -0.44 |
| TPSA | 34.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.78 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|