C10H11N3S — CID 101471357
2-methylsulfanyl-3-phenylimidazol-4-amine (PubChem CID 101471357) has the molecular formula C10H11N3S and a molecular weight of 205.29 g/mol. Its IUPAC name is 2-methylsulfanyl-3-phenylimidazol-4-amine.
| Compound Name | 2-methylsulfanyl-3-phenylimidazol-4-amine |
|---|---|
| PubChem CID | 101471357 |
| Molecular Formula | C10H11N3S |
| Molecular Weight | 205.29 g/mol |
| Exact Mass | 205.07 |
| IUPAC Name | 2-methylsulfanyl-3-phenylimidazol-4-amine |
| SMILES | CSc1ncc(N)n1-c1ccccc1 |
| InChI | InChI=1S/C10H11N3S/c1-14-10-12-7-9(11)13(10)8-5-3-2-4-6-8/h2-7H,11H2,1H3 |
| InChIKey | SIKVUEDETHQEOM-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.29 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |