C19H17FN2O3S — CID 29486807
2-(2-fluorophenoxy)ethyl 2-methylsulfanyl-3-phenylimidazole-4-carboxylate (PubChem CID 29486807) has the molecular formula C19H17FN2O3S and a molecular weight of 372.42 g/mol. Its IUPAC name is 2-(2-fluorophenoxy)ethyl 2-methylsulfanyl-3-phenylimidazole-4-carboxylate.
| Compound Name | 2-(2-fluorophenoxy)ethyl 2-methylsulfanyl-3-phenylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 29486807 |
| Molecular Formula | C19H17FN2O3S |
| Molecular Weight | 372.42 g/mol |
| Exact Mass | 372.09 |
| IUPAC Name | 2-(2-fluorophenoxy)ethyl 2-methylsulfanyl-3-phenylimidazole-4-carboxylate |
| SMILES | CSc1ncc(C(=O)OCCOc2ccccc2F)n1-c1ccccc1 |
| InChI | InChI=1S/C19H17FN2O3S/c1-26-19-21-13-16(22(19)14-7-3-2-4-8-14)18(23)25-12-11-24-17-10-6-5-9-15(17)20/h2-10,13H,11-12H2,1H3 |
| InChIKey | UWYZDBFUPQWYNC-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 53.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.42 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|