C13H12FN3O3S — CID 18085557
(2-amino-2-oxoethyl) 3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxylate (PubChem CID 18085557) has the molecular formula C13H12FN3O3S and a molecular weight of 309.32 g/mol. Its IUPAC name is (2-amino-2-oxoethyl) 3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxylate.
| Compound Name | (2-amino-2-oxoethyl) 3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 18085557 |
| Molecular Formula | C13H12FN3O3S |
| Molecular Weight | 309.32 g/mol |
| Exact Mass | 309.06 |
| IUPAC Name | (2-amino-2-oxoethyl) 3-(4-fluorophenyl)-2-methylsulfanylimidazole-4-carboxylate |
| SMILES | CSc1ncc(C(=O)OCC(N)=O)n1-c1ccc(F)cc1 |
| InChI | InChI=1S/C13H12FN3O3S/c1-21-13-16-6-10(12(19)20-7-11(15)18)17(13)9-4-2-8(14)3-5-9/h2-6H,7H2,1H3,(H2,15,18) |
| InChIKey | BJEUYDSSOREHQC-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 87.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.32 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |