C19H18N2O5S — CID 29486941
(3-ethoxycarbonylfuran-2-yl)methyl 2-methylsulfanyl-3-phenylimidazole-4-carboxylate (PubChem CID 29486941) has the molecular formula C19H18N2O5S and a molecular weight of 386.43 g/mol. Its IUPAC name is (3-ethoxycarbonylfuran-2-yl)methyl 2-methylsulfanyl-3-phenylimidazole-4-carboxylate.
| Compound Name | (3-ethoxycarbonylfuran-2-yl)methyl 2-methylsulfanyl-3-phenylimidazole-4-carboxylate |
|---|---|
| PubChem CID | 29486941 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | (3-ethoxycarbonylfuran-2-yl)methyl 2-methylsulfanyl-3-phenylimidazole-4-carboxylate |
| SMILES | CCOC(=O)c1ccoc1COC(=O)c1cnc(SC)n1-c1ccccc1 |
| InChI | InChI=1S/C19H18N2O5S/c1-3-24-17(22)14-9-10-25-16(14)12-26-18(23)15-11-20-19(27-2)21(15)13-7-5-4-6-8-13/h4-11H,3,12H2,1-2H3 |
| InChIKey | JDQOSRHQAOPIAI-UHFFFAOYSA-N |
| XLogP | 3.72 |
| TPSA | 83.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 3.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |