C11H15ClN4O2 — CID 2858267
ethyl 2-(2,3-diaminobenzimidazol-1-ium-1-yl)acetate chloride (PubChem CID 2858267) has the molecular formula C11H15ClN4O2 and a molecular weight of 270.72 g/mol. Its IUPAC name is ethyl 2-(2,3-diaminobenzimidazol-1-ium-1-yl)acetate chloride.
| Compound Name | ethyl 2-(2,3-diaminobenzimidazol-1-ium-1-yl)acetate chloride |
|---|---|
| PubChem CID | 2858267 |
| Molecular Formula | C11H15ClN4O2 |
| Molecular Weight | 270.72 g/mol |
| Exact Mass | 270.09 |
| IUPAC Name | ethyl 2-(2,3-diaminobenzimidazol-1-ium-1-yl)acetate chloride |
| SMILES | CCOC(=O)C[n+]1c(N)n(N)c2ccccc21.[Cl-] |
| InChI | InChI=1S/C11H14N4O2.ClH/c1-2-17-10(16)7-14-8-5-3-4-6-9(8)15(13)11(14)12;/h3-6,12H,2,7,13H2,1H3;1H |
| InChIKey | HUJCAUGQYQJOAU-UHFFFAOYSA-N |
| XLogP | -3.21 |
| TPSA | 87.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.72 |
| LogP ≤ 5 | -3.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|