C20H22O6Pb — CID 59450494
[diacetyloxy-(2,6-dimethyl-4-phenylphenyl)plumbyl] acetate (PubChem CID 59450494) has the molecular formula C20H22O6Pb and a molecular weight of 565.59 g/mol. Its IUPAC name is [diacetyloxy-(2,6-dimethyl-4-phenylphenyl)plumbyl] acetate.
| Compound Name | [diacetyloxy-(2,6-dimethyl-4-phenylphenyl)plumbyl] acetate |
|---|---|
| PubChem CID | 59450494 |
| Molecular Formula | C20H22O6Pb |
| Molecular Weight | 565.59 g/mol |
| Exact Mass | 566.12 |
| IUPAC Name | [diacetyloxy-(2,6-dimethyl-4-phenylphenyl)plumbyl] acetate |
| SMILES | CC(=O)O[Pb](OC(C)=O)(OC(C)=O)c1c(C)cc(-c2ccccc2)cc1C |
| InChI | InChI=1S/C14H13.3C2H4O2.Pb/c1-11-8-12(2)10-14(9-11)13-6-4-3-5-7-13;3*1-2(3)4;/h3-7,9-10H,1-2H3;3*1H3,(H,3,4);/q;;;;+3/p-3 |
| InChIKey | IJZWYHFLJALAMC-UHFFFAOYSA-K |
| XLogP | 2.81 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 565.59 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |