About CID 68659666
CID 68659666 (PubChem CID 68659666) has the molecular formula C14H14OSi
and a molecular weight of 226.35 g/mol.
Molecular Properties
| Compound Name | CID 68659666 |
| PubChem CID | 68659666 |
| Molecular Formula | C14H14OSi |
| Molecular Weight | 226.35 g/mol |
| Exact Mass | 226.08 |
| IUPAC Name | — |
| SMILES | Cc1cc(-c2ccccc2)cc(C)c1[Si]O |
| InChI | InChI=1S/C14H14OSi/c1-10-8-13(9-11(2)14(10)16-15)12-6-4-3-5-7-12/h3-9,15H,1-2H3 |
| InChIKey | PDYGRVQFAGNOPT-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze CID 68659666 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 68659666?
The IUPAC name of CID 68659666 (CID 68659666) is not available.
What is the SMILES notation for CID 68659666?
The canonical SMILES for CID 68659666 is Cc1cc(-c2ccccc2)cc(C)c1[Si]O.
What is the InChIKey of CID 68659666?
The InChIKey is PDYGRVQFAGNOPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H14OSi/c1-10-8-13(9-11(2)14(10)16-15)12-6-4-3-5-7-12/h3-9,15H,1-2H3.
What are the key properties of CID 68659666?
CID 68659666 has a molecular weight of 226.35 g/mol, XLogP of 2.21, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for CID 68659666 is sourced from PubChem (CID 68659666), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).