C14H16O2Si — CID 154110069
(2,6-dimethyl-4-phenylphenyl)-dihydroxysilane (PubChem CID 154110069) has the molecular formula C14H16O2Si and a molecular weight of 244.37 g/mol. Its IUPAC name is (2,6-dimethyl-4-phenylphenyl)-dihydroxysilane.
| Compound Name | (2,6-dimethyl-4-phenylphenyl)-dihydroxysilane |
|---|---|
| PubChem CID | 154110069 |
| Molecular Formula | C14H16O2Si |
| Molecular Weight | 244.37 g/mol |
| Exact Mass | 244.09 |
| IUPAC Name | (2,6-dimethyl-4-phenylphenyl)-dihydroxysilane |
| SMILES | Cc1cc(-c2ccccc2)cc(C)c1[SiH](O)O |
| InChI | InChI=1S/C14H16O2Si/c1-10-8-13(12-6-4-3-5-7-12)9-11(2)14(10)17(15)16/h3-9,15-17H,1-2H3 |
| InChIKey | ISCZJTBGLWSINN-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.37 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|