C18H19O3P — CID 118537026
1-ethoxy-3,7-dimethyl-4-phenyl-2,1λ5-benzoxaphosphinine 1-oxide (PubChem CID 118537026) has the molecular formula C18H19O3P and a molecular weight of 314.32 g/mol. Its IUPAC name is 1-ethoxy-3,7-dimethyl-4-phenyl-2,1λ5-benzoxaphosphinine 1-oxide.
| Compound Name | 1-ethoxy-3,7-dimethyl-4-phenyl-2,1λ5-benzoxaphosphinine 1-oxide |
|---|---|
| PubChem CID | 118537026 |
| Molecular Formula | C18H19O3P |
| Molecular Weight | 314.32 g/mol |
| Exact Mass | 314.11 |
| IUPAC Name | 1-ethoxy-3,7-dimethyl-4-phenyl-2,1λ5-benzoxaphosphinine 1-oxide |
| SMILES | CCOP1(=O)OC(C)=C(c2ccccc2)c2ccc(C)cc21 |
| InChI | InChI=1S/C18H19O3P/c1-4-20-22(19)17-12-13(2)10-11-16(17)18(14(3)21-22)15-8-6-5-7-9-15/h5-12H,4H2,1-3H3 |
| InChIKey | CKNVDGPFHWJDRC-UHFFFAOYSA-N |
| XLogP | 4.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.32 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|