C18H27O3P — CID 118537009
3,4-dibutyl-1-ethoxy-2,1λ5-benzoxaphosphinine 1-oxide (PubChem CID 118537009) has the molecular formula C18H27O3P and a molecular weight of 322.39 g/mol. Its IUPAC name is 3,4-dibutyl-1-ethoxy-2,1λ5-benzoxaphosphinine 1-oxide.
| Compound Name | 3,4-dibutyl-1-ethoxy-2,1λ5-benzoxaphosphinine 1-oxide |
|---|---|
| PubChem CID | 118537009 |
| Molecular Formula | C18H27O3P |
| Molecular Weight | 322.39 g/mol |
| Exact Mass | 322.17 |
| IUPAC Name | 3,4-dibutyl-1-ethoxy-2,1λ5-benzoxaphosphinine 1-oxide |
| SMILES | CCCCC1=C(CCCC)c2ccccc2P(=O)(OCC)O1 |
| InChI | InChI=1S/C18H27O3P/c1-4-7-11-15-16-12-9-10-14-18(16)22(19,20-6-3)21-17(15)13-8-5-2/h9-10,12,14H,4-8,11,13H2,1-3H3 |
| InChIKey | KTFUZNPZNYDDAP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.39 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|