C17H17O4P — CID 101373984
2-ethoxy-3-(4-methylphenyl)-2-oxo-1,2λ5-benzoxaphosphinin-4-ol (PubChem CID 101373984) has the molecular formula C17H17O4P and a molecular weight of 316.29 g/mol. Its IUPAC name is 2-ethoxy-3-(4-methylphenyl)-2-oxo-1,2λ5-benzoxaphosphinin-4-ol.
| Compound Name | 2-ethoxy-3-(4-methylphenyl)-2-oxo-1,2λ5-benzoxaphosphinin-4-ol |
|---|---|
| PubChem CID | 101373984 |
| Molecular Formula | C17H17O4P |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.09 |
| IUPAC Name | 2-ethoxy-3-(4-methylphenyl)-2-oxo-1,2λ5-benzoxaphosphinin-4-ol |
| SMILES | CCOP1(=O)Oc2ccccc2C(O)=C1c1ccc(C)cc1 |
| InChI | InChI=1S/C17H17O4P/c1-3-20-22(19)17(13-10-8-12(2)9-11-13)16(18)14-6-4-5-7-15(14)21-22/h4-11,18H,3H2,1-2H3 |
| InChIKey | WKEOZVHJLUIQOP-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|