C10H11O5P — CID 15584654
ethyl 2-(2-oxo-1,3,2lambda5-benzodioxaphosphol-2-yl)acetate (PubChem CID 15584654) has the molecular formula C10H11O5P and a molecular weight of 242.17 g/mol. Its IUPAC name is ethyl 2-(2-oxo-1,3,2lambda5-benzodioxaphosphol-2-yl)acetate.
| Compound Name | ethyl 2-(2-oxo-1,3,2lambda5-benzodioxaphosphol-2-yl)acetate |
|---|---|
| PubChem CID | 15584654 |
| Molecular Formula | C10H11O5P |
| Molecular Weight | 242.17 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | ethyl 2-(2-oxo-1,3,2lambda5-benzodioxaphosphol-2-yl)acetate |
| SMILES | CCOC(=O)CP1(=O)Oc2ccccc2O1 |
| InChI | InChI=1S/C10H11O5P/c1-2-13-10(11)7-16(12)14-8-5-3-4-6-9(8)15-16/h3-6H,2,7H2,1H3 |
| InChIKey | QRJCDBYFXIYSRI-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.17 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|