C10H15O2PS — CID 12705789
ethyl 2-(3,4-dimethyl-1-sulfanylidene-1λ5-phosphol-1-yl)acetate (PubChem CID 12705789) has the molecular formula C10H15O2PS and a molecular weight of 230.27 g/mol. Its IUPAC name is ethyl 2-(3,4-dimethyl-1-sulfanylidene-1λ5-phosphol-1-yl)acetate.
| Compound Name | ethyl 2-(3,4-dimethyl-1-sulfanylidene-1λ5-phosphol-1-yl)acetate |
|---|---|
| PubChem CID | 12705789 |
| Molecular Formula | C10H15O2PS |
| Molecular Weight | 230.27 g/mol |
| Exact Mass | 230.05 |
| IUPAC Name | ethyl 2-(3,4-dimethyl-1-sulfanylidene-1λ5-phosphol-1-yl)acetate |
| SMILES | CCOC(=O)CP1(=S)C=C(C)C(C)=C1 |
| InChI | InChI=1S/C10H15O2PS/c1-4-12-10(11)7-13(14)5-8(2)9(3)6-13/h5-6H,4,7H2,1-3H3 |
| InChIKey | LPFQVDUIIJDDBU-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.27 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|