About ethyl 2-[(2-ethoxy-2-oxoethyl)-trihydroxy-λ5-phosphanyl]acetate
ethyl 2-[(2-ethoxy-2-oxoethyl)-trihydroxy-λ5-phosphanyl]acetate (PubChem CID 57217162) has the molecular formula C8H17O7P
and a molecular weight of 256.19 g/mol. Its IUPAC name is ethyl 2-[(2-ethoxy-2-oxoethyl)-trihydroxy-λ5-phosphanyl]acetate.
Molecular Properties
| Compound Name | ethyl 2-[(2-ethoxy-2-oxoethyl)-trihydroxy-λ5-phosphanyl]acetate |
| PubChem CID | 57217162 |
| Molecular Formula | C8H17O7P |
| Molecular Weight | 256.19 g/mol |
| Exact Mass | 256.07 |
| IUPAC Name | ethyl 2-[(2-ethoxy-2-oxoethyl)-trihydroxy-λ5-phosphanyl]acetate |
| SMILES | CCOC(=O)CP(O)(O)(O)CC(=O)OCC |
| InChI | InChI=1S/C8H17O7P/c1-3-14-7(9)5-16(11,12,13)6-8(10)15-4-2/h11-13H,3-6H2,1-2H3 |
| InChIKey | TWRZMOVZWZJNFX-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 113.29 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 256.19 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze ethyl 2-[(2-ethoxy-2-oxoethyl)-trihydroxy-λ5-phosphanyl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 2-[(2-ethoxy-2-oxoethyl)-trihydroxy-λ5-phosphanyl]acetate?
The IUPAC name of ethyl 2-[(2-ethoxy-2-oxoethyl)-trihydroxy-λ5-phosphanyl]acetate (CID 57217162) is ethyl 2-[(2-ethoxy-2-oxoethyl)-trihydroxy-λ5-phosphanyl]acetate.
What is the SMILES notation for ethyl 2-[(2-ethoxy-2-oxoethyl)-trihydroxy-λ5-phosphanyl]acetate?
The canonical SMILES for ethyl 2-[(2-ethoxy-2-oxoethyl)-trihydroxy-λ5-phosphanyl]acetate is CCOC(=O)CP(O)(O)(O)CC(=O)OCC.
What is the InChIKey of ethyl 2-[(2-ethoxy-2-oxoethyl)-trihydroxy-λ5-phosphanyl]acetate?
The InChIKey is TWRZMOVZWZJNFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H17O7P/c1-3-14-7(9)5-16(11,12,13)6-8(10)15-4-2/h11-13H,3-6H2,1-2H3.
What are the key properties of ethyl 2-[(2-ethoxy-2-oxoethyl)-trihydroxy-λ5-phosphanyl]acetate?
ethyl 2-[(2-ethoxy-2-oxoethyl)-trihydroxy-λ5-phosphanyl]acetate has a molecular weight of 256.19 g/mol, XLogP of -0.61, 6 rotatable bonds, 3 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 2-[(2-ethoxy-2-oxoethyl)-trihydroxy-λ5-phosphanyl]acetate is sourced from PubChem (CID 57217162), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).