About potassium;ethyl 2-hydroxyacetate;hydride
potassium;ethyl 2-hydroxyacetate;hydride (PubChem CID 174939573) has the molecular formula C4H9KO3
and a molecular weight of 144.21 g/mol. Its IUPAC name is potassium;ethyl 2-hydroxyacetate;hydride.
Molecular Properties
| Compound Name | potassium;ethyl 2-hydroxyacetate;hydride |
| PubChem CID | 174939573 |
| Molecular Formula | C4H9KO3 |
| Molecular Weight | 144.21 g/mol |
| Exact Mass | 144.02 |
| IUPAC Name | potassium;ethyl 2-hydroxyacetate;hydride |
| SMILES | CCOC(=O)CO.[H-].[K+] |
| InChI | InChI=1S/C4H8O3.K.H/c1-2-7-4(6)3-5;;/h5H,2-3H2,1H3;;/q;+1;-1 |
| InChIKey | JXFAQFNRYNYPDV-UHFFFAOYSA-N |
| XLogP | -3.34 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.21 |
| LogP ≤ 5 | -3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium;ethyl 2-hydroxyacetate;hydride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;ethyl 2-hydroxyacetate;hydride?
The IUPAC name of potassium;ethyl 2-hydroxyacetate;hydride (CID 174939573) is potassium;ethyl 2-hydroxyacetate;hydride.
What is the SMILES notation for potassium;ethyl 2-hydroxyacetate;hydride?
The canonical SMILES for potassium;ethyl 2-hydroxyacetate;hydride is CCOC(=O)CO.[H-].[K+].
What is the InChIKey of potassium;ethyl 2-hydroxyacetate;hydride?
The InChIKey is JXFAQFNRYNYPDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O3.K.H/c1-2-7-4(6)3-5;;/h5H,2-3H2,1H3;;/q;+1;-1.
What are the key properties of potassium;ethyl 2-hydroxyacetate;hydride?
potassium;ethyl 2-hydroxyacetate;hydride has a molecular weight of 144.21 g/mol, XLogP of -3.34, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;ethyl 2-hydroxyacetate;hydride is sourced from PubChem (CID 174939573), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).