C10H11O6P — CID 151175243
ethyl 2-(2-hydroxy-2-oxo-1,3,2λ5-benzodioxaphosphol-4-yl)acetate (PubChem CID 151175243) has the molecular formula C10H11O6P and a molecular weight of 258.17 g/mol. Its IUPAC name is ethyl 2-(2-hydroxy-2-oxo-1,3,2λ5-benzodioxaphosphol-4-yl)acetate.
| Compound Name | ethyl 2-(2-hydroxy-2-oxo-1,3,2λ5-benzodioxaphosphol-4-yl)acetate |
|---|---|
| PubChem CID | 151175243 |
| Molecular Formula | C10H11O6P |
| Molecular Weight | 258.17 g/mol |
| Exact Mass | 258.03 |
| IUPAC Name | ethyl 2-(2-hydroxy-2-oxo-1,3,2λ5-benzodioxaphosphol-4-yl)acetate |
| SMILES | CCOC(=O)Cc1cccc2c1OP(=O)(O)O2 |
| InChI | InChI=1S/C10H11O6P/c1-2-14-9(11)6-7-4-3-5-8-10(7)16-17(12,13)15-8/h3-5H,2,6H2,1H3,(H,12,13) |
| InChIKey | NDDBKCDAELTXDO-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 82.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.17 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|