C20H18BrO5P — CID 142733820
methyl (E)-3-(8-bromo-2-ethoxy-2-oxo-4-phenyl-1,2λ5-benzoxaphosphinin-3-yl)prop-2-enoate (PubChem CID 142733820) has the molecular formula C20H18BrO5P and a molecular weight of 449.24 g/mol. Its IUPAC name is methyl (E)-3-(8-bromo-2-ethoxy-2-oxo-4-phenyl-1,2λ5-benzoxaphosphinin-3-yl)prop-2-enoate.
| Compound Name | methyl (E)-3-(8-bromo-2-ethoxy-2-oxo-4-phenyl-1,2λ5-benzoxaphosphinin-3-yl)prop-2-enoate |
|---|---|
| PubChem CID | 142733820 |
| Molecular Formula | C20H18BrO5P |
| Molecular Weight | 449.24 g/mol |
| Exact Mass | 448.01 |
| IUPAC Name | methyl (E)-3-(8-bromo-2-ethoxy-2-oxo-4-phenyl-1,2λ5-benzoxaphosphinin-3-yl)prop-2-enoate |
| SMILES | CCOP1(=O)Oc2c(Br)cccc2C(c2ccccc2)=C1/C=C/C(=O)OC |
| InChI | InChI=1S/C20H18BrO5P/c1-3-25-27(23)17(12-13-18(22)24-2)19(14-8-5-4-6-9-14)15-10-7-11-16(21)20(15)26-27/h4-13H,3H2,1-2H3/b13-12+ |
| InChIKey | WIZDWOWIQYSBJR-OUKQBFOZSA-N |
| XLogP | 5.56 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.24 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|