C23H25O6P — CID 142733799
methyl (E)-3-[2-ethoxy-4-(4-methoxyphenyl)-5,7-dimethyl-2-oxo-1,2λ5-benzoxaphosphinin-3-yl]prop-2-enoate (PubChem CID 142733799) has the molecular formula C23H25O6P and a molecular weight of 428.42 g/mol. Its IUPAC name is methyl (E)-3-[2-ethoxy-4-(4-methoxyphenyl)-5,7-dimethyl-2-oxo-1,2λ5-benzoxaphosphinin-3-yl]prop-2-enoate.
| Compound Name | methyl (E)-3-[2-ethoxy-4-(4-methoxyphenyl)-5,7-dimethyl-2-oxo-1,2λ5-benzoxaphosphinin-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 142733799 |
| Molecular Formula | C23H25O6P |
| Molecular Weight | 428.42 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | methyl (E)-3-[2-ethoxy-4-(4-methoxyphenyl)-5,7-dimethyl-2-oxo-1,2λ5-benzoxaphosphinin-3-yl]prop-2-enoate |
| SMILES | CCOP1(=O)Oc2cc(C)cc(C)c2C(c2ccc(OC)cc2)=C1/C=C/C(=O)OC |
| InChI | InChI=1S/C23H25O6P/c1-6-28-30(25)20(11-12-21(24)27-5)23(17-7-9-18(26-4)10-8-17)22-16(3)13-15(2)14-19(22)29-30/h7-14H,6H2,1-5H3/b12-11+ |
| InChIKey | YSEYFPPPKFREPQ-VAWYXSNFSA-N |
| XLogP | 5.42 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.42 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|