About ethane;methyl (E)-3-[5-ethoxy-2-(2-hydroxyethoxy)phenyl]prop-2-enoate
ethane;methyl (E)-3-[5-ethoxy-2-(2-hydroxyethoxy)phenyl]prop-2-enoate (PubChem CID 142930615) has the molecular formula C16H24O5
and a molecular weight of 296.36 g/mol. Its IUPAC name is ethane;methyl (E)-3-[5-ethoxy-2-(2-hydroxyethoxy)phenyl]prop-2-enoate.
Molecular Properties
| Compound Name | ethane;methyl (E)-3-[5-ethoxy-2-(2-hydroxyethoxy)phenyl]prop-2-enoate |
| PubChem CID | 142930615 |
| Molecular Formula | C16H24O5 |
| Molecular Weight | 296.36 g/mol |
| Exact Mass | 296.16 |
| IUPAC Name | ethane;methyl (E)-3-[5-ethoxy-2-(2-hydroxyethoxy)phenyl]prop-2-enoate |
| SMILES | CC.CCOc1ccc(OCCO)c(/C=C/C(=O)OC)c1 |
| InChI | InChI=1S/C14H18O5.C2H6/c1-3-18-12-5-6-13(19-9-8-15)11(10-12)4-7-14(16)17-2;1-2/h4-7,10,15H,3,8-9H2,1-2H3;1-2H3/b7-4+; |
| InChIKey | NUYXBIQQUINYBJ-KQGICBIGSA-N |
| XLogP | 2.67 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 296.36 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethane;methyl (E)-3-[5-ethoxy-2-(2-hydroxyethoxy)phenyl]prop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methyl (E)-3-[5-ethoxy-2-(2-hydroxyethoxy)phenyl]prop-2-enoate?
The IUPAC name of ethane;methyl (E)-3-[5-ethoxy-2-(2-hydroxyethoxy)phenyl]prop-2-enoate (CID 142930615) is ethane;methyl (E)-3-[5-ethoxy-2-(2-hydroxyethoxy)phenyl]prop-2-enoate.
What is the SMILES notation for ethane;methyl (E)-3-[5-ethoxy-2-(2-hydroxyethoxy)phenyl]prop-2-enoate?
The canonical SMILES for ethane;methyl (E)-3-[5-ethoxy-2-(2-hydroxyethoxy)phenyl]prop-2-enoate is CC.CCOc1ccc(OCCO)c(/C=C/C(=O)OC)c1.
What is the InChIKey of ethane;methyl (E)-3-[5-ethoxy-2-(2-hydroxyethoxy)phenyl]prop-2-enoate?
The InChIKey is NUYXBIQQUINYBJ-KQGICBIGSA-N. The full InChI is InChI=1S/C14H18O5.C2H6/c1-3-18-12-5-6-13(19-9-8-15)11(10-12)4-7-14(16)17-2;1-2/h4-7,10,15H,3,8-9H2,1-2H3;1-2H3/b7-4+;.
What are the key properties of ethane;methyl (E)-3-[5-ethoxy-2-(2-hydroxyethoxy)phenyl]prop-2-enoate?
ethane;methyl (E)-3-[5-ethoxy-2-(2-hydroxyethoxy)phenyl]prop-2-enoate has a molecular weight of 296.36 g/mol, XLogP of 2.67, 7 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methyl (E)-3-[5-ethoxy-2-(2-hydroxyethoxy)phenyl]prop-2-enoate is sourced from PubChem (CID 142930615), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).