C21H20O2 — CID 10638224
3-butyl-6-methyl-2-phenylnaphthalene-1,4-dione (PubChem CID 10638224) has the molecular formula C21H20O2 and a molecular weight of 304.39 g/mol. Its IUPAC name is 3-butyl-6-methyl-2-phenylnaphthalene-1,4-dione.
| Compound Name | 3-butyl-6-methyl-2-phenylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 10638224 |
| Molecular Formula | C21H20O2 |
| Molecular Weight | 304.39 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 3-butyl-6-methyl-2-phenylnaphthalene-1,4-dione |
| SMILES | CCCCC1=C(c2ccccc2)C(=O)c2ccc(C)cc2C1=O |
| InChI | InChI=1S/C21H20O2/c1-3-4-10-17-19(15-8-6-5-7-9-15)21(23)16-12-11-14(2)13-18(16)20(17)22/h5-9,11-13H,3-4,10H2,1-2H3 |
| InChIKey | ZBFWERKJCGPVFM-UHFFFAOYSA-N |
| XLogP | 5.02 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.39 |
| LogP ≤ 5 | 5.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|