C21H27BO4 — CID 101108078
3-butyl-6-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1,4-dione (PubChem CID 101108078) has the molecular formula C21H27BO4 and a molecular weight of 354.26 g/mol. Its IUPAC name is 3-butyl-6-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1,4-dione.
| Compound Name | 3-butyl-6-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1,4-dione |
|---|---|
| PubChem CID | 101108078 |
| Molecular Formula | C21H27BO4 |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 354.20 |
| IUPAC Name | 3-butyl-6-methyl-2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)naphthalene-1,4-dione |
| SMILES | CCCCC1=C(B2OC(C)(C)C(C)(C)O2)C(=O)c2ccc(C)cc2C1=O |
| InChI | InChI=1S/C21H27BO4/c1-7-8-9-15-17(22-25-20(3,4)21(5,6)26-22)19(24)14-11-10-13(2)12-16(14)18(15)23/h10-12H,7-9H2,1-6H3 |
| InChIKey | YEXPASCINRQXJJ-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|