C16H18O2 — CID 10444415
2-butyl-3,6-dimethylnaphthalene-1,4-dione (PubChem CID 10444415) has the molecular formula C16H18O2 and a molecular weight of 242.32 g/mol. Its IUPAC name is 2-butyl-3,6-dimethylnaphthalene-1,4-dione.
| Compound Name | 2-butyl-3,6-dimethylnaphthalene-1,4-dione |
|---|---|
| PubChem CID | 10444415 |
| Molecular Formula | C16H18O2 |
| Molecular Weight | 242.32 g/mol |
| Exact Mass | 242.13 |
| IUPAC Name | 2-butyl-3,6-dimethylnaphthalene-1,4-dione |
| SMILES | CCCCC1=C(C)C(=O)c2cc(C)ccc2C1=O |
| InChI | InChI=1S/C16H18O2/c1-4-5-6-12-11(3)15(17)14-9-10(2)7-8-13(14)16(12)18/h7-9H,4-6H2,1-3H3 |
| InChIKey | LQHWCRCIPTXODB-UHFFFAOYSA-N |
| XLogP | 3.88 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.32 |
| LogP ≤ 5 | 3.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|