C28H24O6 — CID 144562615
3-[6-butyl-7-(3-methyl-1,4-dioxonaphthalen-2-yl)-5,8-dioxonaphthalen-2-yl]propanoic acid (PubChem CID 144562615) has the molecular formula C28H24O6 and a molecular weight of 456.49 g/mol. Its IUPAC name is 3-[6-butyl-7-(3-methyl-1,4-dioxonaphthalen-2-yl)-5,8-dioxonaphthalen-2-yl]propanoic acid.
| Compound Name | 3-[6-butyl-7-(3-methyl-1,4-dioxonaphthalen-2-yl)-5,8-dioxonaphthalen-2-yl]propanoic acid |
|---|---|
| PubChem CID | 144562615 |
| Molecular Formula | C28H24O6 |
| Molecular Weight | 456.49 g/mol |
| Exact Mass | 456.16 |
| IUPAC Name | 3-[6-butyl-7-(3-methyl-1,4-dioxonaphthalen-2-yl)-5,8-dioxonaphthalen-2-yl]propanoic acid |
| SMILES | CCCCC1=C(C2=C(C)C(=O)c3ccccc3C2=O)C(=O)c2cc(CCC(=O)O)ccc2C1=O |
| InChI | InChI=1S/C28H24O6/c1-3-4-7-20-24(23-15(2)25(31)17-8-5-6-9-18(17)27(23)33)28(34)21-14-16(11-13-22(29)30)10-12-19(21)26(20)32/h5-6,8-10,12,14H,3-4,7,11,13H2,1-2H3,(H,29,30) |
| InChIKey | QOCQFAODIKGAKN-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 105.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.49 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|