C14H12O4 — CID 102396276
3-(7-methyl-5,8-dioxonaphthalen-2-yl)propanoic acid (PubChem CID 102396276) has the molecular formula C14H12O4 and a molecular weight of 244.25 g/mol. Its IUPAC name is 3-(7-methyl-5,8-dioxonaphthalen-2-yl)propanoic acid.
| Compound Name | 3-(7-methyl-5,8-dioxonaphthalen-2-yl)propanoic acid |
|---|---|
| PubChem CID | 102396276 |
| Molecular Formula | C14H12O4 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.07 |
| IUPAC Name | 3-(7-methyl-5,8-dioxonaphthalen-2-yl)propanoic acid |
| SMILES | CC1=CC(=O)c2ccc(CCC(=O)O)cc2C1=O |
| InChI | InChI=1S/C14H12O4/c1-8-6-12(15)10-4-2-9(3-5-13(16)17)7-11(10)14(8)18/h2,4,6-7H,3,5H2,1H3,(H,16,17) |
| InChIKey | XVKQDEQEMNQTBV-UHFFFAOYSA-N |
| XLogP | 2.03 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|