C16H14O6 — CID 161333112
(2S)-2-(hydroxymethyl)-4-(6-methyl-5,8-dioxonaphthalen-2-yl)-4-oxobutanoic acid (PubChem CID 161333112) has the molecular formula C16H14O6 and a molecular weight of 302.28 g/mol. Its IUPAC name is (2S)-2-(hydroxymethyl)-4-(6-methyl-5,8-dioxonaphthalen-2-yl)-4-oxobutanoic acid.
| Compound Name | (2S)-2-(hydroxymethyl)-4-(6-methyl-5,8-dioxonaphthalen-2-yl)-4-oxobutanoic acid |
|---|---|
| PubChem CID | 161333112 |
| Molecular Formula | C16H14O6 |
| Molecular Weight | 302.28 g/mol |
| Exact Mass | 302.08 |
| IUPAC Name | (2S)-2-(hydroxymethyl)-4-(6-methyl-5,8-dioxonaphthalen-2-yl)-4-oxobutanoic acid |
| SMILES | CC1=CC(=O)c2cc(C(=O)C[C@@H](CO)C(=O)O)ccc2C1=O |
| InChI | InChI=1S/C16H14O6/c1-8-4-14(19)12-5-9(2-3-11(12)15(8)20)13(18)6-10(7-17)16(21)22/h2-5,10,17H,6-7H2,1H3,(H,21,22)/t10-/m0/s1 |
| InChIKey | UYVNLRLCMBAZKN-JTQLQIEISA-N |
| XLogP | 1.28 |
| TPSA | 108.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.28 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|