C20H21FO3 — CID 139887967
2-[2-[4-(4-fluorophenyl)phenyl]-2-oxoethyl]-4-methylpentanoic acid (PubChem CID 139887967) has the molecular formula C20H21FO3 and a molecular weight of 328.38 g/mol. Its IUPAC name is 2-[2-[4-(4-fluorophenyl)phenyl]-2-oxoethyl]-4-methylpentanoic acid.
| Compound Name | 2-[2-[4-(4-fluorophenyl)phenyl]-2-oxoethyl]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 139887967 |
| Molecular Formula | C20H21FO3 |
| Molecular Weight | 328.38 g/mol |
| Exact Mass | 328.15 |
| IUPAC Name | 2-[2-[4-(4-fluorophenyl)phenyl]-2-oxoethyl]-4-methylpentanoic acid |
| SMILES | CC(C)CC(CC(=O)c1ccc(-c2ccc(F)cc2)cc1)C(=O)O |
| InChI | InChI=1S/C20H21FO3/c1-13(2)11-17(20(23)24)12-19(22)16-5-3-14(4-6-16)15-7-9-18(21)10-8-15/h3-10,13,17H,11-12H2,1-2H3,(H,23,24) |
| InChIKey | UQKXUABILRTCOJ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.38 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |