About methyl 6-methyl-5,8-dioxonaphthalene-2-carboxylate
methyl 6-methyl-5,8-dioxonaphthalene-2-carboxylate (PubChem CID 12772824) has the molecular formula C13H10O4
and a molecular weight of 230.22 g/mol. Its IUPAC name is methyl 6-methyl-5,8-dioxonaphthalene-2-carboxylate.
Molecular Properties
| Compound Name | methyl 6-methyl-5,8-dioxonaphthalene-2-carboxylate |
| PubChem CID | 12772824 |
| Molecular Formula | C13H10O4 |
| Molecular Weight | 230.22 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | methyl 6-methyl-5,8-dioxonaphthalene-2-carboxylate |
| SMILES | COC(=O)c1ccc2c(c1)C(=O)C=C(C)C2=O |
| InChI | InChI=1S/C13H10O4/c1-7-5-11(14)10-6-8(13(16)17-2)3-4-9(10)12(7)15/h3-6H,1-2H3 |
| InChIKey | MFGPYPPMCMSXSG-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 60.44 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.22 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|
Analyze methyl 6-methyl-5,8-dioxonaphthalene-2-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 6-methyl-5,8-dioxonaphthalene-2-carboxylate?
The IUPAC name of methyl 6-methyl-5,8-dioxonaphthalene-2-carboxylate (CID 12772824) is methyl 6-methyl-5,8-dioxonaphthalene-2-carboxylate.
What is the SMILES notation for methyl 6-methyl-5,8-dioxonaphthalene-2-carboxylate?
The canonical SMILES for methyl 6-methyl-5,8-dioxonaphthalene-2-carboxylate is COC(=O)c1ccc2c(c1)C(=O)C=C(C)C2=O.
What is the InChIKey of methyl 6-methyl-5,8-dioxonaphthalene-2-carboxylate?
The InChIKey is MFGPYPPMCMSXSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H10O4/c1-7-5-11(14)10-6-8(13(16)17-2)3-4-9(10)12(7)15/h3-6H,1-2H3.
What are the key properties of methyl 6-methyl-5,8-dioxonaphthalene-2-carboxylate?
methyl 6-methyl-5,8-dioxonaphthalene-2-carboxylate has a molecular weight of 230.22 g/mol, XLogP of 1.80, 1 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 6-methyl-5,8-dioxonaphthalene-2-carboxylate is sourced from PubChem (CID 12772824), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).