C11H15O2P — CID 135080518
1-ethoxy-3,4-dihydro-2H-phosphinoline 1-oxide (PubChem CID 135080518) has the molecular formula C11H15O2P and a molecular weight of 210.21 g/mol. Its IUPAC name is 1-ethoxy-3,4-dihydro-2H-phosphinoline 1-oxide.
| Compound Name | 1-ethoxy-3,4-dihydro-2H-phosphinoline 1-oxide |
|---|---|
| PubChem CID | 135080518 |
| Molecular Formula | C11H15O2P |
| Molecular Weight | 210.21 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | 1-ethoxy-3,4-dihydro-2H-phosphinoline 1-oxide |
| SMILES | CCOP1(=O)CCCc2ccccc21 |
| InChI | InChI=1S/C11H15O2P/c1-2-13-14(12)9-5-7-10-6-3-4-8-11(10)14/h3-4,6,8H,2,5,7,9H2,1H3 |
| InChIKey | IJSYDQXGEAEMDA-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.21 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|