C24H33O7P — CID 102392416
(10R,20R)-2-ethoxy-10,20-dimethyl-9,12,15,18,21-pentaoxa-2λ5-phosphatricyclo[20.4.0.03,8]hexacosa-1(26),3,5,7,22,24-hexaene 2-oxide (PubChem CID 102392416) has the molecular formula C24H33O7P and a molecular weight of 464.50 g/mol. Its IUPAC name is (10R,20R)-2-ethoxy-10,20-dimethyl-9,12,15,18,21-pentaoxa-2λ5-phosphatricyclo[20.4.0.03,8]hexacosa-1(26),3,5,7,22,24-hexaene 2-oxide.
| Compound Name | (10R,20R)-2-ethoxy-10,20-dimethyl-9,12,15,18,21-pentaoxa-2λ5-phosphatricyclo[20.4.0.03,8]hexacosa-1(26),3,5,7,22,24-hexaene 2-oxide |
|---|---|
| PubChem CID | 102392416 |
| Molecular Formula | C24H33O7P |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.20 |
| IUPAC Name | (10R,20R)-2-ethoxy-10,20-dimethyl-9,12,15,18,21-pentaoxa-2λ5-phosphatricyclo[20.4.0.03,8]hexacosa-1(26),3,5,7,22,24-hexaene 2-oxide |
| SMILES | CCOP1(=O)c2ccccc2O[C@H](C)COCCOCCOC[C@@H](C)Oc2ccccc21 |
| InChI | InChI=1S/C24H33O7P/c1-4-29-32(25)23-11-7-5-9-21(23)30-19(2)17-27-15-13-26-14-16-28-18-20(3)31-22-10-6-8-12-24(22)32/h5-12,19-20H,4,13-18H2,1-3H3/t19-,20-/m1/s1 |
| InChIKey | UDSKWRPFRPQAIN-WOJBJXKFSA-N |
| XLogP | 3.55 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|