C27H23O4P — CID 146390169
4-[1-(4-methoxyphenyl)-1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)ethyl]phenol (PubChem CID 146390169) has the molecular formula C27H23O4P and a molecular weight of 442.45 g/mol. Its IUPAC name is 4-[1-(4-methoxyphenyl)-1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)ethyl]phenol.
| Compound Name | 4-[1-(4-methoxyphenyl)-1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)ethyl]phenol |
|---|---|
| PubChem CID | 146390169 |
| Molecular Formula | C27H23O4P |
| Molecular Weight | 442.45 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | 4-[1-(4-methoxyphenyl)-1-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)ethyl]phenol |
| SMILES | COc1ccc(C(C)(c2ccc(O)cc2)P2(=O)Oc3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C27H23O4P/c1-27(19-11-15-21(28)16-12-19,20-13-17-22(30-2)18-14-20)32(29)26-10-6-4-8-24(26)23-7-3-5-9-25(23)31-32/h3-18,28H,1-2H3 |
| InChIKey | DWFIECVTTCRATG-UHFFFAOYSA-N |
| XLogP | 6.33 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.45 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|