C33H32N3O2P — CID 162139572
4-[bis(4-aminophenyl)-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]aniline;ethane (PubChem CID 162139572) has the molecular formula C33H32N3O2P and a molecular weight of 533.61 g/mol. Its IUPAC name is 4-[bis(4-aminophenyl)-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]aniline;ethane.
| Compound Name | 4-[bis(4-aminophenyl)-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]aniline;ethane |
|---|---|
| PubChem CID | 162139572 |
| Molecular Formula | C33H32N3O2P |
| Molecular Weight | 533.61 g/mol |
| Exact Mass | 533.22 |
| IUPAC Name | 4-[bis(4-aminophenyl)-(6-oxobenzo[c][2,1]benzoxaphosphinin-6-yl)methyl]aniline;ethane |
| SMILES | CC.Nc1ccc(C(c2ccc(N)cc2)(c2ccc(N)cc2)P2(=O)Oc3ccccc3-c3ccccc32)cc1 |
| InChI | InChI=1S/C31H26N3O2P.C2H6/c32-24-15-9-21(10-16-24)31(22-11-17-25(33)18-12-22,23-13-19-26(34)20-14-23)37(35)30-8-4-2-6-28(30)27-5-1-3-7-29(27)36-37;1-2/h1-20H,32-34H2;1-2H3 |
| InChIKey | ZJTBMFOEPUPABR-UHFFFAOYSA-N |
| XLogP | 7.41 |
| TPSA | 104.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.61 |
| LogP ≤ 5 | 7.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_F(14)', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|