C18H27O4P — CID 25214874
3-butyl-2-ethoxy-4-(4-methoxyphenyl)-5,5-dimethyl-1,2λ5-oxaphosphole 2-oxide (PubChem CID 25214874) has the molecular formula C18H27O4P and a molecular weight of 338.38 g/mol. Its IUPAC name is 3-butyl-2-ethoxy-4-(4-methoxyphenyl)-5,5-dimethyl-1,2λ5-oxaphosphole 2-oxide.
| Compound Name | 3-butyl-2-ethoxy-4-(4-methoxyphenyl)-5,5-dimethyl-1,2λ5-oxaphosphole 2-oxide |
|---|---|
| PubChem CID | 25214874 |
| Molecular Formula | C18H27O4P |
| Molecular Weight | 338.38 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | 3-butyl-2-ethoxy-4-(4-methoxyphenyl)-5,5-dimethyl-1,2λ5-oxaphosphole 2-oxide |
| SMILES | CCCCC1=C(c2ccc(OC)cc2)C(C)(C)OP1(=O)OCC |
| InChI | InChI=1S/C18H27O4P/c1-6-8-9-16-17(14-10-12-15(20-5)13-11-14)18(3,4)22-23(16,19)21-7-2/h10-13H,6-9H2,1-5H3 |
| InChIKey | BLHLPXZLRZANQG-UHFFFAOYSA-N |
| XLogP | 5.63 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.38 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|