About 2,3-dibutyl-6-methoxy-1-(4-methoxyphenyl)phosphindole 1-oxide
2,3-dibutyl-6-methoxy-1-(4-methoxyphenyl)phosphindole 1-oxide (PubChem CID 134843929) has the molecular formula C24H31O3P
and a molecular weight of 398.48 g/mol. Its IUPAC name is 2,3-dibutyl-6-methoxy-1-(4-methoxyphenyl)phosphindole 1-oxide.
Molecular Properties
| Compound Name | 2,3-dibutyl-6-methoxy-1-(4-methoxyphenyl)phosphindole 1-oxide |
| PubChem CID | 134843929 |
| Molecular Formula | C24H31O3P |
| Molecular Weight | 398.48 g/mol |
| Exact Mass | 398.20 |
| IUPAC Name | 2,3-dibutyl-6-methoxy-1-(4-methoxyphenyl)phosphindole 1-oxide |
| SMILES | CCCCC1=C(CCCC)P(=O)(c2ccc(OC)cc2)c2cc(OC)ccc21 |
| InChI | InChI=1S/C24H31O3P/c1-5-7-9-21-22-16-13-19(27-4)17-24(22)28(25,23(21)10-8-6-2)20-14-11-18(26-3)12-15-20/h11-17H,5-10H2,1-4H3 |
| InChIKey | RAVZALBEZMPDDJ-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 398.48 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze 2,3-dibutyl-6-methoxy-1-(4-methoxyphenyl)phosphindole 1-oxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-dibutyl-6-methoxy-1-(4-methoxyphenyl)phosphindole 1-oxide?
The IUPAC name of 2,3-dibutyl-6-methoxy-1-(4-methoxyphenyl)phosphindole 1-oxide (CID 134843929) is 2,3-dibutyl-6-methoxy-1-(4-methoxyphenyl)phosphindole 1-oxide.
What is the SMILES notation for 2,3-dibutyl-6-methoxy-1-(4-methoxyphenyl)phosphindole 1-oxide?
The canonical SMILES for 2,3-dibutyl-6-methoxy-1-(4-methoxyphenyl)phosphindole 1-oxide is CCCCC1=C(CCCC)P(=O)(c2ccc(OC)cc2)c2cc(OC)ccc21.
What is the InChIKey of 2,3-dibutyl-6-methoxy-1-(4-methoxyphenyl)phosphindole 1-oxide?
The InChIKey is RAVZALBEZMPDDJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H31O3P/c1-5-7-9-21-22-16-13-19(27-4)17-24(22)28(25,23(21)10-8-6-2)20-14-11-18(26-3)12-15-20/h11-17H,5-10H2,1-4H3.
What are the key properties of 2,3-dibutyl-6-methoxy-1-(4-methoxyphenyl)phosphindole 1-oxide?
2,3-dibutyl-6-methoxy-1-(4-methoxyphenyl)phosphindole 1-oxide has a molecular weight of 398.48 g/mol, XLogP of 6.12, 9 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-dibutyl-6-methoxy-1-(4-methoxyphenyl)phosphindole 1-oxide is sourced from PubChem (CID 134843929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).