C27H31O2P — CID 102047261
3,7-ditert-butyl-5-(4-methoxyphenyl)benzo[b]phosphindole 5-oxide (PubChem CID 102047261) has the molecular formula C27H31O2P and a molecular weight of 418.52 g/mol. Its IUPAC name is 3,7-ditert-butyl-5-(4-methoxyphenyl)benzo[b]phosphindole 5-oxide.
| Compound Name | 3,7-ditert-butyl-5-(4-methoxyphenyl)benzo[b]phosphindole 5-oxide |
|---|---|
| PubChem CID | 102047261 |
| Molecular Formula | C27H31O2P |
| Molecular Weight | 418.52 g/mol |
| Exact Mass | 418.21 |
| IUPAC Name | 3,7-ditert-butyl-5-(4-methoxyphenyl)benzo[b]phosphindole 5-oxide |
| SMILES | COc1ccc(P2(=O)c3cc(C(C)(C)C)ccc3-c3ccc(C(C)(C)C)cc32)cc1 |
| InChI | InChI=1S/C27H31O2P/c1-26(2,3)18-8-14-22-23-15-9-19(27(4,5)6)17-25(23)30(28,24(22)16-18)21-12-10-20(29-7)11-13-21/h8-17H,1-7H3 |
| InChIKey | POMHVHQXSVOSPI-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.52 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|