C26H30O6 — CID 86224004
1,4-bis[dimethoxy-(4-methoxyphenyl)methyl]benzene (PubChem CID 86224004) has the molecular formula C26H30O6 and a molecular weight of 438.52 g/mol. Its IUPAC name is 1,4-bis[dimethoxy-(4-methoxyphenyl)methyl]benzene.
| Compound Name | 1,4-bis[dimethoxy-(4-methoxyphenyl)methyl]benzene |
|---|---|
| PubChem CID | 86224004 |
| Molecular Formula | C26H30O6 |
| Molecular Weight | 438.52 g/mol |
| Exact Mass | 438.20 |
| IUPAC Name | 1,4-bis[dimethoxy-(4-methoxyphenyl)methyl]benzene |
| SMILES | COc1ccc(C(OC)(OC)c2ccc(C(OC)(OC)c3ccc(OC)cc3)cc2)cc1 |
| InChI | InChI=1S/C26H30O6/c1-27-23-15-11-21(12-16-23)25(29-3,30-4)19-7-9-20(10-8-19)26(31-5,32-6)22-13-17-24(28-2)18-14-22/h7-18H,1-6H3 |
| InChIKey | YEJPJBSPEZGWGJ-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 55.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.52 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|