About 4-[[4-[dimethoxy-(4-methoxyphenyl)methyl]phenyl]-iodo-phenyl-λ4-sulfanyl]phenol
4-[[4-[dimethoxy-(4-methoxyphenyl)methyl]phenyl]-iodo-phenyl-λ4-sulfanyl]phenol (PubChem CID 169083088) has the molecular formula C28H27IO4S
and a molecular weight of 586.49 g/mol. Its IUPAC name is 4-[[4-[dimethoxy-(4-methoxyphenyl)methyl]phenyl]-iodo-phenyl-λ4-sulfanyl]phenol.
Molecular Properties
| Compound Name | 4-[[4-[dimethoxy-(4-methoxyphenyl)methyl]phenyl]-iodo-phenyl-λ4-sulfanyl]phenol |
| PubChem CID | 169083088 |
| Molecular Formula | C28H27IO4S |
| Molecular Weight | 586.49 g/mol |
| Exact Mass | 586.07 |
| IUPAC Name | 4-[[4-[dimethoxy-(4-methoxyphenyl)methyl]phenyl]-iodo-phenyl-λ4-sulfanyl]phenol |
| SMILES | COc1ccc(C(OC)(OC)c2ccc(S(I)(c3ccccc3)c3ccc(O)cc3)cc2)cc1 |
| InChI | InChI=1S/C28H27IO4S/c1-31-24-15-9-21(10-16-24)28(32-2,33-3)22-11-17-26(18-12-22)34(29,25-7-5-4-6-8-25)27-19-13-23(30)14-20-27/h4-20,30H,1-3H3 |
| InChIKey | WFXGQDRIYXDSGI-UHFFFAOYSA-N |
| XLogP | 7.53 |
| TPSA | 47.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 586.49 |
| LogP ≤ 5 | 7.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 4-[[4-[dimethoxy-(4-methoxyphenyl)methyl]phenyl]-iodo-phenyl-λ4-sulfanyl]phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[[4-[dimethoxy-(4-methoxyphenyl)methyl]phenyl]-iodo-phenyl-λ4-sulfanyl]phenol?
The IUPAC name of 4-[[4-[dimethoxy-(4-methoxyphenyl)methyl]phenyl]-iodo-phenyl-λ4-sulfanyl]phenol (CID 169083088) is 4-[[4-[dimethoxy-(4-methoxyphenyl)methyl]phenyl]-iodo-phenyl-λ4-sulfanyl]phenol.
What is the SMILES notation for 4-[[4-[dimethoxy-(4-methoxyphenyl)methyl]phenyl]-iodo-phenyl-λ4-sulfanyl]phenol?
The canonical SMILES for 4-[[4-[dimethoxy-(4-methoxyphenyl)methyl]phenyl]-iodo-phenyl-λ4-sulfanyl]phenol is COc1ccc(C(OC)(OC)c2ccc(S(I)(c3ccccc3)c3ccc(O)cc3)cc2)cc1.
What is the InChIKey of 4-[[4-[dimethoxy-(4-methoxyphenyl)methyl]phenyl]-iodo-phenyl-λ4-sulfanyl]phenol?
The InChIKey is WFXGQDRIYXDSGI-UHFFFAOYSA-N. The full InChI is InChI=1S/C28H27IO4S/c1-31-24-15-9-21(10-16-24)28(32-2,33-3)22-11-17-26(18-12-22)34(29,25-7-5-4-6-8-25)27-19-13-23(30)14-20-27/h4-20,30H,1-3H3.
What are the key properties of 4-[[4-[dimethoxy-(4-methoxyphenyl)methyl]phenyl]-iodo-phenyl-λ4-sulfanyl]phenol?
4-[[4-[dimethoxy-(4-methoxyphenyl)methyl]phenyl]-iodo-phenyl-λ4-sulfanyl]phenol has a molecular weight of 586.49 g/mol, XLogP of 7.53, 8 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[[4-[dimethoxy-(4-methoxyphenyl)methyl]phenyl]-iodo-phenyl-λ4-sulfanyl]phenol is sourced from PubChem (CID 169083088), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).