C17H17Cl3O3 — CID 91491822
1-methoxy-4-[2,2,2-trichloro-1-methoxy-1-(4-methoxyphenyl)ethyl]benzene (PubChem CID 91491822) has the molecular formula C17H17Cl3O3 and a molecular weight of 375.68 g/mol. Its IUPAC name is 1-methoxy-4-[2,2,2-trichloro-1-methoxy-1-(4-methoxyphenyl)ethyl]benzene.
| Compound Name | 1-methoxy-4-[2,2,2-trichloro-1-methoxy-1-(4-methoxyphenyl)ethyl]benzene |
|---|---|
| PubChem CID | 91491822 |
| Molecular Formula | C17H17Cl3O3 |
| Molecular Weight | 375.68 g/mol |
| Exact Mass | 374.02 |
| IUPAC Name | 1-methoxy-4-[2,2,2-trichloro-1-methoxy-1-(4-methoxyphenyl)ethyl]benzene |
| SMILES | COc1ccc(C(OC)(c2ccc(OC)cc2)C(Cl)(Cl)Cl)cc1 |
| InChI | InChI=1S/C17H17Cl3O3/c1-21-14-8-4-12(5-9-14)16(23-3,17(18,19)20)13-6-10-15(22-2)11-7-13/h4-11H,1-3H3 |
| InChIKey | DNTQRDBYTSNDMF-UHFFFAOYSA-N |
| XLogP | 4.96 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.68 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|