C19H27O4P — CID 25215103
1-[4-(3-butyl-2-ethoxy-5,5-dimethyl-2-oxo-1,2λ5-oxaphosphol-4-yl)phenyl]ethanone (PubChem CID 25215103) has the molecular formula C19H27O4P and a molecular weight of 350.40 g/mol. Its IUPAC name is 1-[4-(3-butyl-2-ethoxy-5,5-dimethyl-2-oxo-1,2λ5-oxaphosphol-4-yl)phenyl]ethanone.
| Compound Name | 1-[4-(3-butyl-2-ethoxy-5,5-dimethyl-2-oxo-1,2λ5-oxaphosphol-4-yl)phenyl]ethanone |
|---|---|
| PubChem CID | 25215103 |
| Molecular Formula | C19H27O4P |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.16 |
| IUPAC Name | 1-[4-(3-butyl-2-ethoxy-5,5-dimethyl-2-oxo-1,2λ5-oxaphosphol-4-yl)phenyl]ethanone |
| SMILES | CCCCC1=C(c2ccc(C(C)=O)cc2)C(C)(C)OP1(=O)OCC |
| InChI | InChI=1S/C19H27O4P/c1-6-8-9-17-18(16-12-10-15(11-13-16)14(3)20)19(4,5)23-24(17,21)22-7-2/h10-13H,6-9H2,1-5H3 |
| InChIKey | LPPXUVSPUITZLT-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|