C33H30O5 — CID 102308408
dimethyl 6-(4-acetylphenyl)-11-butylbenzo[a]fluorene-5,5-dicarboxylate (PubChem CID 102308408) has the molecular formula C33H30O5 and a molecular weight of 506.60 g/mol. Its IUPAC name is dimethyl 6-(4-acetylphenyl)-11-butylbenzo[a]fluorene-5,5-dicarboxylate.
| Compound Name | dimethyl 6-(4-acetylphenyl)-11-butylbenzo[a]fluorene-5,5-dicarboxylate |
|---|---|
| PubChem CID | 102308408 |
| Molecular Formula | C33H30O5 |
| Molecular Weight | 506.60 g/mol |
| Exact Mass | 506.21 |
| IUPAC Name | dimethyl 6-(4-acetylphenyl)-11-butylbenzo[a]fluorene-5,5-dicarboxylate |
| SMILES | CCCCC1=C2C(=C(c3ccc(C(C)=O)cc3)C(C(=O)OC)(C(=O)OC)c3ccccc32)c2ccccc21 |
| InChI | InChI=1S/C33H30O5/c1-5-6-11-24-23-12-7-8-13-25(23)29-28(24)26-14-9-10-15-27(26)33(31(35)37-3,32(36)38-4)30(29)22-18-16-21(17-19-22)20(2)34/h7-10,12-19H,5-6,11H2,1-4H3 |
| InChIKey | VJRWRCZUIAIBBD-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.60 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|