C20H18O5 — CID 126715852
dimethyl 3-(hydroxymethyl)-2-phenylindene-1,1-dicarboxylate (PubChem CID 126715852) has the molecular formula C20H18O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is dimethyl 3-(hydroxymethyl)-2-phenylindene-1,1-dicarboxylate.
| Compound Name | dimethyl 3-(hydroxymethyl)-2-phenylindene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 126715852 |
| Molecular Formula | C20H18O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | dimethyl 3-(hydroxymethyl)-2-phenylindene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C(c2ccccc2)=C(CO)c2ccccc21 |
| InChI | InChI=1S/C20H18O5/c1-24-18(22)20(19(23)25-2)16-11-7-6-10-14(16)15(12-21)17(20)13-8-4-3-5-9-13/h3-11,21H,12H2,1-2H3 |
| InChIKey | ITKNAXPZOLVKNQ-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|