C20H18O2 — CID 175165492
methyl 1-(2-phenylphenyl)cyclohexa-2,4-diene-1-carboxylate (PubChem CID 175165492) has the molecular formula C20H18O2 and a molecular weight of 290.36 g/mol. Its IUPAC name is methyl 1-(2-phenylphenyl)cyclohexa-2,4-diene-1-carboxylate.
| Compound Name | methyl 1-(2-phenylphenyl)cyclohexa-2,4-diene-1-carboxylate |
|---|---|
| PubChem CID | 175165492 |
| Molecular Formula | C20H18O2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | methyl 1-(2-phenylphenyl)cyclohexa-2,4-diene-1-carboxylate |
| SMILES | COC(=O)C1(c2ccccc2-c2ccccc2)C=CC=CC1 |
| InChI | InChI=1S/C20H18O2/c1-22-19(21)20(14-8-3-9-15-20)18-13-7-6-12-17(18)16-10-4-2-5-11-16/h2-14H,15H2,1H3 |
| InChIKey | AAIGDQXUMUVPRU-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |