C16H16O4 — CID 175230851
dimethyl 5-phenylcyclohexa-2,4-diene-1,1-dicarboxylate (PubChem CID 175230851) has the molecular formula C16H16O4 and a molecular weight of 272.30 g/mol. Its IUPAC name is dimethyl 5-phenylcyclohexa-2,4-diene-1,1-dicarboxylate.
| Compound Name | dimethyl 5-phenylcyclohexa-2,4-diene-1,1-dicarboxylate |
|---|---|
| PubChem CID | 175230851 |
| Molecular Formula | C16H16O4 |
| Molecular Weight | 272.30 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | dimethyl 5-phenylcyclohexa-2,4-diene-1,1-dicarboxylate |
| SMILES | COC(=O)C1(C(=O)OC)C=CC=C(c2ccccc2)C1 |
| InChI | InChI=1S/C16H16O4/c1-19-14(17)16(15(18)20-2)10-6-9-13(11-16)12-7-4-3-5-8-12/h3-10H,11H2,1-2H3 |
| InChIKey | LHRFHEBLHMJMMA-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.30 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|