About 5-phenylcyclohexa-2,4-diene-1,1-dicarbaldehyde
5-phenylcyclohexa-2,4-diene-1,1-dicarbaldehyde (PubChem CID 130276656) has the molecular formula C14H12O2
and a molecular weight of 212.25 g/mol. Its IUPAC name is 5-phenylcyclohexa-2,4-diene-1,1-dicarbaldehyde.
Molecular Properties
| Compound Name | 5-phenylcyclohexa-2,4-diene-1,1-dicarbaldehyde |
| PubChem CID | 130276656 |
| Molecular Formula | C14H12O2 |
| Molecular Weight | 212.25 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 5-phenylcyclohexa-2,4-diene-1,1-dicarbaldehyde |
| SMILES | O=CC1(C=O)C=CC=C(c2ccccc2)C1 |
| InChI | InChI=1S/C14H12O2/c15-10-14(11-16)8-4-7-13(9-14)12-5-2-1-3-6-12/h1-8,10-11H,9H2 |
| InChIKey | JHPKSRZYUSLRDI-UHFFFAOYSA-N |
| XLogP | 2.41 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|
Analyze 5-phenylcyclohexa-2,4-diene-1,1-dicarbaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenylcyclohexa-2,4-diene-1,1-dicarbaldehyde?
The IUPAC name of 5-phenylcyclohexa-2,4-diene-1,1-dicarbaldehyde (CID 130276656) is 5-phenylcyclohexa-2,4-diene-1,1-dicarbaldehyde.
What is the SMILES notation for 5-phenylcyclohexa-2,4-diene-1,1-dicarbaldehyde?
The canonical SMILES for 5-phenylcyclohexa-2,4-diene-1,1-dicarbaldehyde is O=CC1(C=O)C=CC=C(c2ccccc2)C1.
What is the InChIKey of 5-phenylcyclohexa-2,4-diene-1,1-dicarbaldehyde?
The InChIKey is JHPKSRZYUSLRDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12O2/c15-10-14(11-16)8-4-7-13(9-14)12-5-2-1-3-6-12/h1-8,10-11H,9H2.
What are the key properties of 5-phenylcyclohexa-2,4-diene-1,1-dicarbaldehyde?
5-phenylcyclohexa-2,4-diene-1,1-dicarbaldehyde has a molecular weight of 212.25 g/mol, XLogP of 2.41, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenylcyclohexa-2,4-diene-1,1-dicarbaldehyde is sourced from PubChem (CID 130276656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).