C18H21NO3 — CID 175485910
tert-butyl N-(1-formyl-5-phenylcyclohexa-2,4-dien-1-yl)carbamate (PubChem CID 175485910) has the molecular formula C18H21NO3 and a molecular weight of 299.37 g/mol. Its IUPAC name is tert-butyl N-(1-formyl-5-phenylcyclohexa-2,4-dien-1-yl)carbamate.
| Compound Name | tert-butyl N-(1-formyl-5-phenylcyclohexa-2,4-dien-1-yl)carbamate |
|---|---|
| PubChem CID | 175485910 |
| Molecular Formula | C18H21NO3 |
| Molecular Weight | 299.37 g/mol |
| Exact Mass | 299.15 |
| IUPAC Name | tert-butyl N-(1-formyl-5-phenylcyclohexa-2,4-dien-1-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1(C=O)C=CC=C(c2ccccc2)C1 |
| InChI | InChI=1S/C18H21NO3/c1-17(2,3)22-16(21)19-18(13-20)11-7-10-15(12-18)14-8-5-4-6-9-14/h4-11,13H,12H2,1-3H3,(H,19,21) |
| InChIKey | GFUULLZMHPHDDN-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.37 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|